C25H27ClN10O — CID 123994341
2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-methylpropanamide (PubChem CID 123994341) has the molecular formula C25H27ClN10O and a molecular weight of 519.01 g/mol. Its IUPAC name is 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-methylpropanamide.
| Compound Name | 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 123994341 |
| Molecular Formula | C25H27ClN10O |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-methylpropanamide |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(C4CCN(C(C)(C)C(N)=O)CC4)c3Cl)nn12 |
| InChI | InChI=1S/C25H27ClN10O/c1-25(2,23(28)37)35-8-6-15(7-9-35)17-10-14(12-27)11-18(20(17)26)32-24-33-21(31-16-4-5-16)22-30-13-19(29-3)36(22)34-24/h10-11,13,15-16H,4-9H2,1-2H3,(H2,28,37)(H2,31,32,33,34) |
| InChIKey | YZITWQUFUWCSCO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|