C23H22ClN11O2 — CID 123552254
2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-oxopiperazin-1-yl]-N-methylacetamide (PubChem CID 123552254) has the molecular formula C23H22ClN11O2 and a molecular weight of 519.96 g/mol. Its IUPAC name is 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-oxopiperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-oxopiperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 123552254 |
| Molecular Formula | C23H22ClN11O2 |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[4-[2-chloro-5-cyano-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]-3-oxopiperazin-1-yl]-N-methylacetamide |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(N4CCN(CC(=O)NC)CC4=O)c3Cl)nn12 |
| InChI | InChI=1S/C23H22ClN11O2/c1-26-17-10-28-22-21(29-14-3-4-14)31-23(32-35(17)22)30-15-7-13(9-25)8-16(20(15)24)34-6-5-33(12-19(34)37)11-18(36)27-2/h7-8,10,14H,3-6,11-12H2,2H3,(H,27,36)(H2,29,30,31,32) |
| InChIKey | BTQNJTNZBKQFEL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|