C19H18ClN9 — CID 123269446
4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[(dimethylamino)methyl]benzonitrile (PubChem CID 123269446) has the molecular formula C19H18ClN9 and a molecular weight of 407.87 g/mol. Its IUPAC name is 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[(dimethylamino)methyl]benzonitrile.
| Compound Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[(dimethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 123269446 |
| Molecular Formula | C19H18ClN9 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[(dimethylamino)methyl]benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(CN(C)C)c3Cl)nn12 |
| InChI | InChI=1S/C19H18ClN9/c1-22-15-9-23-18-17(24-13-4-5-13)26-19(27-29(15)18)25-14-7-11(8-21)6-12(16(14)20)10-28(2)3/h6-7,9,13H,4-5,10H2,2-3H3,(H2,24,25,26,27) |
| InChIKey | RTYWAHURHCSIML-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|