C18H13ClF2N8O — CID 123152808
4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(1,1-difluoro-2-hydroxyethyl)benzonitrile (PubChem CID 123152808) has the molecular formula C18H13ClF2N8O and a molecular weight of 430.81 g/mol. Its IUPAC name is 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(1,1-difluoro-2-hydroxyethyl)benzonitrile.
| Compound Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(1,1-difluoro-2-hydroxyethyl)benzonitrile |
|---|---|
| PubChem CID | 123152808 |
| Molecular Formula | C18H13ClF2N8O |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(1,1-difluoro-2-hydroxyethyl)benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(C(F)(F)CO)c3Cl)nn12 |
| InChI | InChI=1S/C18H13ClF2N8O/c1-23-13-7-24-16-15(25-10-2-3-10)27-17(28-29(13)16)26-12-5-9(6-22)4-11(14(12)19)18(20,21)8-30/h4-5,7,10,30H,2-3,8H2,(H2,25,26,27,28) |
| InChIKey | DFBVPULSENYWML-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|