C23H22ClN9O2 — CID 123682401
4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]benzonitrile (PubChem CID 123682401) has the molecular formula C23H22ClN9O2 and a molecular weight of 491.94 g/mol. Its IUPAC name is 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]benzonitrile.
| Compound Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123682401 |
| Molecular Formula | C23H22ClN9O2 |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(C4(O)CCN(C5COC5)C4)c3Cl)nn12 |
| InChI | InChI=1S/C23H22ClN9O2/c1-26-18-9-27-21-20(28-14-2-3-14)30-22(31-33(18)21)29-17-7-13(8-25)6-16(19(17)24)23(34)4-5-32(12-23)15-10-35-11-15/h6-7,9,14-15,34H,2-5,10-12H2,(H2,28,29,30,31) |
| InChIKey | OFNZYBVWFSSXFV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|