C14H16Cl2N2O2 — CID 118254331
[(8S)-8-(chloromethyl)-1-methyl-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-4-yl] acetate;hydrochloride (PubChem CID 118254331) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is [(8S)-8-(chloromethyl)-1-methyl-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-4-yl] acetate;hydrochloride.
| Compound Name | [(8S)-8-(chloromethyl)-1-methyl-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-4-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 118254331 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [(8S)-8-(chloromethyl)-1-methyl-3,6,7,8-tetrahydropyrrolo[3,2-e]indol-4-yl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cc2c(c3c(C)c[nH]c13)[C@H](CCl)CN2.Cl |
| InChI | InChI=1S/C14H15ClN2O2.ClH/c1-7-5-17-14-11(19-8(2)18)3-10-13(12(7)14)9(4-15)6-16-10;/h3,5,9,16-17H,4,6H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | IHTZGDJRHLTMBB-SBSPUUFOSA-N |
| XLogP | 3.57 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|