C14H14ClNO2S — CID 122529735
[(8R)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl] acetate (PubChem CID 122529735) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is [(8R)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl] acetate.
| Compound Name | [(8R)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl] acetate |
|---|---|
| PubChem CID | 122529735 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | [(8R)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c3sc(C)cc13)[C@@H](CCl)CN2 |
| InChI | InChI=1S/C14H14ClNO2S/c1-7-3-10-12(18-8(2)17)4-11-13(14(10)19-7)9(5-15)6-16-11/h3-4,9,16H,5-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | YGRDBLHSNXKCES-VIFPVBQESA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|