C20H24ClN3O2 — CID 145156539
[1-(2-chloroethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 145156539) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is [1-(2-chloroethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [1-(2-chloroethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 145156539 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [1-(2-chloroethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2cc3c(c4ccccc24)C(CCCl)CN3)CC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-23-8-10-24(11-9-23)20(25)26-18-12-17-19(14(6-7-21)13-22-17)16-5-3-2-4-15(16)18/h2-5,12,14,22H,6-11,13H2,1H3 |
| InChIKey | ZIQUURCXAMINFA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|