C21H23ClN2O2S2 — CID 175786411
[1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylate (PubChem CID 175786411) has the molecular formula C21H23ClN2O2S2 and a molecular weight of 435.01 g/mol. Its IUPAC name is [1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylate.
| Compound Name | [1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175786411 |
| Molecular Formula | C21H23ClN2O2S2 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-yl] (4aS,8aS)-3,4,4a,5,8,8a-hexahydro-2H-dithiino[4,5-b]pyridine-1-carboxylate |
| SMILES | O=C(Oc1cc2c(c3ccccc13)C(CCl)CN2)N1CCC[C@@H]2CSSC[C@H]21 |
| InChI | InChI=1S/C21H23ClN2O2S2/c22-9-14-10-23-17-8-19(15-5-1-2-6-16(15)20(14)17)26-21(25)24-7-3-4-13-11-27-28-12-18(13)24/h1-2,5-6,8,13-14,18,23H,3-4,7,9-12H2/t13-,14?,18-/m1/s1 |
| InChIKey | SGHOOILEDBOMHT-VZGYSGOJSA-N |
| XLogP | 5.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|