C30H30ClN5O3 — CID 59314514
[(1S)-1-(chloromethyl)-3-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 59314514) has the molecular formula C30H30ClN5O3 and a molecular weight of 544.06 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-3-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [(1S)-1-(chloromethyl)-3-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 59314514 |
| Molecular Formula | C30H30ClN5O3 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | [(1S)-1-(chloromethyl)-3-(3,6,7,8-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-5-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2cc3c(c4ccccc24)[C@H](CCl)CN3C(=O)c2cc3c4c(ccc3[nH]2)NCC4)CC1 |
| InChI | InChI=1S/C30H30ClN5O3/c1-34-10-12-35(13-11-34)30(38)39-27-15-26-28(21-5-3-2-4-20(21)27)18(16-31)17-36(26)29(37)25-14-22-19-8-9-32-23(19)6-7-24(22)33-25/h2-7,14-15,18,32-33H,8-13,16-17H2,1H3/t18-/m1/s1 |
| InChIKey | ICOLUTRMRZSUIG-GOSISDBHSA-N |
| XLogP | 5.02 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|