C14H14ClNO2S — CID 150726063
2-[(8S)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl]acetic acid (PubChem CID 150726063) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is 2-[(8S)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl]acetic acid.
| Compound Name | 2-[(8S)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl]acetic acid |
|---|---|
| PubChem CID | 150726063 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[(8S)-8-(chloromethyl)-2-methyl-7,8-dihydro-6H-thieno[2,3-e]indol-4-yl]acetic acid |
| SMILES | Cc1cc2c(CC(=O)O)cc3c(c2s1)[C@H](CCl)CN3 |
| InChI | InChI=1S/C14H14ClNO2S/c1-7-2-10-8(4-12(17)18)3-11-13(14(10)19-7)9(5-15)6-16-11/h2-3,9,16H,4-6H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | JQVURYONOYWXLG-SECBINFHSA-N |
| XLogP | 3.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|