3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid

C11H13NO2 — CID 174563030

IUPAC3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c1C(C)CN2
InChIInChI=1S/C11H13NO2/c1-6-3-8(11(13)14)4-9-10(6)7(2)5-12-9/h3-4,7,12H,5H2,1-2H3,(H,13,14)
InChIKeyYTAAOCOGGSZYCT-UHFFFAOYSA-N
MW191.23 g/mol
LogP2.22
Rot. Bonds1

About 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid

3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 174563030) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid.

Molecular Properties

Compound Name3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid
PubChem CID174563030
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Name3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c1C(C)CN2
InChIInChI=1S/C11H13NO2/c1-6-3-8(11(13)14)4-9-10(6)7(2)5-12-9/h3-4,7,12H,5H2,1-2H3,(H,13,14)
InChIKeyYTAAOCOGGSZYCT-UHFFFAOYSA-N
XLogP2.22
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The IUPAC name of 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid (CID 174563030) is 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid.
What is the SMILES notation for 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The canonical SMILES for 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid is Cc1cc(C(=O)O)cc2c1C(C)CN2.
What is the InChIKey of 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid?
The InChIKey is YTAAOCOGGSZYCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-6-3-8(11(13)14)4-9-10(6)7(2)5-12-9/h3-4,7,12H,5H2,1-2H3,(H,13,14).
What are the key properties of 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid?
3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid has a molecular weight of 191.23 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,3-dihydro-1H-indole-6-carboxylic acid is sourced from PubChem (CID 174563030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).