C9H16Br2 — CID 118255100
2,3-dibromopropylcyclohexane (PubChem CID 118255100) has the molecular formula C9H16Br2 and a molecular weight of 284.03 g/mol. Its IUPAC name is 2,3-dibromopropylcyclohexane.
| Compound Name | 2,3-dibromopropylcyclohexane |
|---|---|
| PubChem CID | 118255100 |
| Molecular Formula | C9H16Br2 |
| Molecular Weight | 284.03 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 2,3-dibromopropylcyclohexane |
| SMILES | BrCC(Br)CC1CCCCC1 |
| InChI | InChI=1S/C9H16Br2/c10-7-9(11)6-8-4-2-1-3-5-8/h8-9H,1-7H2 |
| InChIKey | XTKIZOCZUKENGG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|