C28H37N5O4 — CID 118256276
tert-butyl 4-[2-amino-5-[3-methyl-4-(oxan-4-yloxy)-2H-indazol-6-yl]phenyl]piperazine-1-carboxylate (PubChem CID 118256276) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-5-[3-methyl-4-(oxan-4-yloxy)-2H-indazol-6-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-5-[3-methyl-4-(oxan-4-yloxy)-2H-indazol-6-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118256276 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | tert-butyl 4-[2-amino-5-[3-methyl-4-(oxan-4-yloxy)-2H-indazol-6-yl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1[nH]nc2cc(-c3ccc(N)c(N4CCN(C(=O)OC(C)(C)C)CC4)c3)cc(OC3CCOCC3)c12 |
| InChI | InChI=1S/C28H37N5O4/c1-18-26-23(31-30-18)15-20(17-25(26)36-21-7-13-35-14-8-21)19-5-6-22(29)24(16-19)32-9-11-33(12-10-32)27(34)37-28(2,3)4/h5-6,15-17,21H,7-14,29H2,1-4H3,(H,30,31) |
| InChIKey | XZBFXNKQBPPUKN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|