C21H26N6O3S — CID 118257342
3-(4-aminocyclohexyl)-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide (PubChem CID 118257342) has the molecular formula C21H26N6O3S and a molecular weight of 442.55 g/mol. Its IUPAC name is 3-(4-aminocyclohexyl)-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide.
| Compound Name | 3-(4-aminocyclohexyl)-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118257342 |
| Molecular Formula | C21H26N6O3S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-(4-aminocyclohexyl)-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzenesulfonamide |
| SMILES | COc1ccc(Cn2nnc(-c3c(C4CCC(N)CC4)cccc3S(N)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C21H26N6O3S/c1-30-17-11-5-14(6-12-17)13-27-25-21(24-26-27)20-18(15-7-9-16(22)10-8-15)3-2-4-19(20)31(23,28)29/h2-6,11-12,15-16H,7-10,13,22H2,1H3,(H2,23,28,29) |
| InChIKey | OBTHGJMGSFDXPM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |