C21H25NO5S — CID 118259212
[4-[[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methylsulfonyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 118259212) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [4-[[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methylsulfonyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methylsulfonyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118259212 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [4-[[2-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methylsulfonyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CO/N=C(\C)c1ccccc1CS(=O)(=O)c1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-15(22-26-5)19-9-7-6-8-16(19)14-28(24,25)18-12-10-17(11-13-18)27-20(23)21(2,3)4/h6-13H,14H2,1-5H3/b22-15+ |
| InChIKey | OBCXDLFXPWVJGR-PXLXIMEGSA-N |
| XLogP | 3.98 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|