C25H33ClN4O3 — CID 118259596
1-(4-chloro-3-methylphenyl)-3-[2-[3-[(E)-C-methyl-N-(2-morpholin-4-ylethoxy)carbonimidoyl]phenyl]propan-2-yl]urea (PubChem CID 118259596) has the molecular formula C25H33ClN4O3 and a molecular weight of 473.02 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[2-[3-[(E)-C-methyl-N-(2-morpholin-4-ylethoxy)carbonimidoyl]phenyl]propan-2-yl]urea.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[2-[3-[(E)-C-methyl-N-(2-morpholin-4-ylethoxy)carbonimidoyl]phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 118259596 |
| Molecular Formula | C25H33ClN4O3 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[2-[3-[(E)-C-methyl-N-(2-morpholin-4-ylethoxy)carbonimidoyl]phenyl]propan-2-yl]urea |
| SMILES | C/C(=N\OCCN1CCOCC1)c1cccc(C(C)(C)NC(=O)Nc2ccc(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C25H33ClN4O3/c1-18-16-22(8-9-23(18)26)27-24(31)28-25(3,4)21-7-5-6-20(17-21)19(2)29-33-15-12-30-10-13-32-14-11-30/h5-9,16-17H,10-15H2,1-4H3,(H2,27,28,31)/b29-19+ |
| InChIKey | RQFBTKBUOGGZGL-VUTHCHCSSA-N |
| XLogP | 4.78 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|