C23H29ClN4O4 — CID 144576161
1-[4-chloro-3-[hydroxy(morpholin-4-yl)methyl]phenyl]-3-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-yl]urea (PubChem CID 144576161) has the molecular formula C23H29ClN4O4 and a molecular weight of 460.96 g/mol. Its IUPAC name is 1-[4-chloro-3-[hydroxy(morpholin-4-yl)methyl]phenyl]-3-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-yl]urea.
| Compound Name | 1-[4-chloro-3-[hydroxy(morpholin-4-yl)methyl]phenyl]-3-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 144576161 |
| Molecular Formula | C23H29ClN4O4 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[4-chloro-3-[hydroxy(morpholin-4-yl)methyl]phenyl]-3-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-yl]urea |
| SMILES | C/C(=N\O)c1cccc(C(C)(C)NC(=O)Nc2ccc(Cl)c(C(O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C23H29ClN4O4/c1-15(27-31)16-5-4-6-17(13-16)23(2,3)26-22(30)25-18-7-8-20(24)19(14-18)21(29)28-9-11-32-12-10-28/h4-8,13-14,21,29,31H,9-12H2,1-3H3,(H2,25,26,30)/b27-15+ |
| InChIKey | KJOUTBPYCXLWIK-JFLMPSFJSA-N |
| XLogP | 3.92 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|