C23H30N2O — CID 71462576
1-(4-tert-butylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 71462576) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 71462576 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H30N2O/c1-16(2)17-9-8-10-19(15-17)23(6,7)25-21(26)24-20-13-11-18(12-14-20)22(3,4)5/h8-15H,1H2,2-7H3,(H2,24,25,26) |
| InChIKey | DRHCZTYWOCYUQU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |