C27H24N2O3 — CID 59816790
1-(9,10-dioxoanthracen-2-yl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 59816790) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1-(9,10-dioxoanthracen-2-yl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-(9,10-dioxoanthracen-2-yl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 59816790 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-(9,10-dioxoanthracen-2-yl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C27H24N2O3/c1-16(2)17-8-7-9-18(14-17)27(3,4)29-26(32)28-19-12-13-22-23(15-19)25(31)21-11-6-5-10-20(21)24(22)30/h5-15H,1H2,2-4H3,(H2,28,29,32) |
| InChIKey | SXVFAONIYMFDPX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|