C22H23N3O — CID 67473072
1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-quinolin-2-ylurea (PubChem CID 67473072) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-quinolin-2-ylurea.
| Compound Name | 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-quinolin-2-ylurea |
|---|---|
| PubChem CID | 67473072 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-quinolin-2-ylurea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)Nc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H23N3O/c1-15(2)17-9-7-10-18(14-17)22(3,4)25-21(26)24-20-13-12-16-8-5-6-11-19(16)23-20/h5-14H,1H2,2-4H3,(H2,23,24,25,26) |
| InChIKey | ZSXBOBMHHCDESR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |