C20H22F2N2OS — CID 2308142
1-[4-(difluoromethylsulfanyl)phenyl]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 2308142) has the molecular formula C20H22F2N2OS and a molecular weight of 376.47 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 2308142 |
| Molecular Formula | C20H22F2N2OS |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H22F2N2OS/c1-13(2)14-6-5-7-15(12-14)20(3,4)24-19(25)23-16-8-10-17(11-9-16)26-18(21)22/h5-12,18H,1H2,2-4H3,(H2,23,24,25) |
| InChIKey | XHVHCNWIYIEKNM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |