C27H37N3O4 — CID 2900241
1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 2900241) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 2900241 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 1-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)Nc2cc(OCC)c(N3CCOCC3)cc2OCC)c1 |
| InChI | InChI=1S/C27H37N3O4/c1-7-33-24-18-23(30-12-14-32-15-13-30)25(34-8-2)17-22(24)28-26(31)29-27(5,6)21-11-9-10-20(16-21)19(3)4/h9-11,16-18H,3,7-8,12-15H2,1-2,4-6H3,(H2,28,29,31) |
| InChIKey | ADQNHJPUGAJHLB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|