C21H24ClN4O5S- — CID 146637073
2-[[2-chloro-5-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-ylcarbamoylamino]benzoyl]amino]ethanesulfinate (PubChem CID 146637073) has the molecular formula C21H24ClN4O5S- and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-[[2-chloro-5-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-ylcarbamoylamino]benzoyl]amino]ethanesulfinate.
| Compound Name | 2-[[2-chloro-5-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-ylcarbamoylamino]benzoyl]amino]ethanesulfinate |
|---|---|
| PubChem CID | 146637073 |
| Molecular Formula | C21H24ClN4O5S- |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[[2-chloro-5-[2-[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]propan-2-ylcarbamoylamino]benzoyl]amino]ethanesulfinate |
| SMILES | C/C(=N\O)c1cccc(C(C)(C)NC(=O)Nc2ccc(Cl)c(C(=O)NCCS(=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H25ClN4O5S/c1-13(26-29)14-5-4-6-15(11-14)21(2,3)25-20(28)24-16-7-8-18(22)17(12-16)19(27)23-9-10-32(30)31/h4-8,11-12,29H,9-10H2,1-3H3,(H,23,27)(H,30,31)(H2,24,25,28)/p-1/b26-13+ |
| InChIKey | BXWFJNYXEFAIBS-LGJNPRDNSA-M |
| XLogP | 3.20 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|