C22H16Cl2N2O3 — CID 118259642
(2R)-2-(2,3-dichlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide (PubChem CID 118259642) has the molecular formula C22H16Cl2N2O3 and a molecular weight of 427.29 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide.
| Compound Name | (2R)-2-(2,3-dichlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 118259642 |
| Molecular Formula | C22H16Cl2N2O3 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
| SMILES | C[C@@H](Oc1cccc(Cl)c1Cl)C(=O)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H16Cl2N2O3/c1-13(28-19-9-5-8-16(23)20(19)24)21(27)25-15-10-11-18-17(12-15)26-22(29-18)14-6-3-2-4-7-14/h2-13H,1H3,(H,25,27)/t13-/m1/s1 |
| InChIKey | AQSMBVKWVWTUOJ-CYBMUJFWSA-N |
| XLogP | 6.21 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |