C26H20N2O3 — CID 67473155
2-naphthalen-1-yloxy-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide (PubChem CID 67473155) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide.
| Compound Name | 2-naphthalen-1-yloxy-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 67473155 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-naphthalen-1-yloxy-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
| SMILES | CC(Oc1cccc2ccccc12)C(=O)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C26H20N2O3/c1-17(30-23-13-7-11-18-8-5-6-12-21(18)23)25(29)27-20-14-15-24-22(16-20)28-26(31-24)19-9-3-2-4-10-19/h2-17H,1H3,(H,27,29) |
| InChIKey | GJWKMXJJKQYZAQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |