C22H17ClN2O3 — CID 118259676
(2S)-2-(2-chlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide (PubChem CID 118259676) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide.
| Compound Name | (2S)-2-(2-chlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 118259676 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (2S)-2-(2-chlorophenoxy)-N-(2-phenyl-1,3-benzoxazol-5-yl)propanamide |
| SMILES | C[C@H](Oc1ccccc1Cl)C(=O)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H17ClN2O3/c1-14(27-19-10-6-5-9-17(19)23)21(26)24-16-11-12-20-18(13-16)25-22(28-20)15-7-3-2-4-8-15/h2-14H,1H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | JDJZZJOJHBPNQQ-AWEZNQCLSA-N |
| XLogP | 5.55 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |