C24H27Cl2FN4O4 — CID 118260756
ethyl (2R,4R)-2-azido-5-[2-chloro-4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 118260756) has the molecular formula C24H27Cl2FN4O4 and a molecular weight of 525.41 g/mol. Its IUPAC name is ethyl (2R,4R)-2-azido-5-[2-chloro-4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | ethyl (2R,4R)-2-azido-5-[2-chloro-4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 118260756 |
| Molecular Formula | C24H27Cl2FN4O4 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | ethyl (2R,4R)-2-azido-5-[2-chloro-4-(5-chloro-2-fluorophenyl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCOC(=O)[C@@H](C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1Cl)NC(=O)OC(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C24H27Cl2FN4O4/c1-5-34-22(32)21(30-31-28)13-17(29-23(33)35-24(2,3)4)10-15-7-6-14(11-19(15)26)18-12-16(25)8-9-20(18)27/h6-9,11-12,17,21H,5,10,13H2,1-4H3,(H,29,33)/t17-,21-/m1/s1 |
| InChIKey | FWBMPBOZHHBDKD-DYESRHJHSA-N |
| XLogP | 6.87 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|