C27H28ClFN4O4 — CID 159467561
ethyl (2R,4R)-2-azido-4-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-oxo-6-(4-propan-2-yl-1,3-oxazol-2-yl)hexanoate (PubChem CID 159467561) has the molecular formula C27H28ClFN4O4 and a molecular weight of 527.00 g/mol. Its IUPAC name is ethyl (2R,4R)-2-azido-4-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-oxo-6-(4-propan-2-yl-1,3-oxazol-2-yl)hexanoate.
| Compound Name | ethyl (2R,4R)-2-azido-4-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-oxo-6-(4-propan-2-yl-1,3-oxazol-2-yl)hexanoate |
|---|---|
| PubChem CID | 159467561 |
| Molecular Formula | C27H28ClFN4O4 |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | ethyl (2R,4R)-2-azido-4-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-6-oxo-6-(4-propan-2-yl-1,3-oxazol-2-yl)hexanoate |
| SMILES | CCOC(=O)[C@@H](CC(CC(=O)c1nc(C(C)C)co1)Cc1ccc(-c2cc(Cl)ccc2F)cc1)N=[N+]=[N-] |
| InChI | InChI=1S/C27H28ClFN4O4/c1-4-36-27(35)23(32-33-30)12-18(13-25(34)26-31-24(15-37-26)16(2)3)11-17-5-7-19(8-6-17)21-14-20(28)9-10-22(21)29/h5-10,14-16,18,23H,4,11-13H2,1-3H3/t18?,23-/m1/s1 |
| InChIKey | QXAIHFKZHDPLSZ-WBPHRXDCSA-N |
| XLogP | 7.32 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|