C18H19BrFN3O5 — CID 118262378
[(2R,3S,5R)-5-[5-bromo-4-(2-hydroxyanilino)-2-oxopyrimidin-1-yl]-2-ethyl-4-fluorooxolan-3-yl] acetate (PubChem CID 118262378) has the molecular formula C18H19BrFN3O5 and a molecular weight of 456.27 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-bromo-4-(2-hydroxyanilino)-2-oxopyrimidin-1-yl]-2-ethyl-4-fluorooxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-[5-bromo-4-(2-hydroxyanilino)-2-oxopyrimidin-1-yl]-2-ethyl-4-fluorooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 118262378 |
| Molecular Formula | C18H19BrFN3O5 |
| Molecular Weight | 456.27 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | [(2R,3S,5R)-5-[5-bromo-4-(2-hydroxyanilino)-2-oxopyrimidin-1-yl]-2-ethyl-4-fluorooxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cc(Br)c(Nc3ccccc3O)nc2=O)C(F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19BrFN3O5/c1-3-13-15(27-9(2)24)14(20)17(28-13)23-8-10(19)16(22-18(23)26)21-11-6-4-5-7-12(11)25/h4-8,13-15,17,25H,3H2,1-2H3,(H,21,22,26)/t13-,14?,15+,17-/m1/s1 |
| InChIKey | VXZHZJBXQGEXNY-LFDXPVSYSA-N |
| XLogP | 3.03 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|