C15H18N4O2 — CID 118262490
11-[(3S)-3-hydroxypiperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118262490) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 11-[(3S)-3-hydroxypiperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[(3S)-3-hydroxypiperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118262490 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 11-[(3S)-3-hydroxypiperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | O=C1NCCc2[nH]c3nc(N4CCC[C@H](O)C4)ccc3c21 |
| InChI | InChI=1S/C15H18N4O2/c20-9-2-1-7-19(8-9)12-4-3-10-13-11(17-14(10)18-12)5-6-16-15(13)21/h3-4,9,20H,1-2,5-8H2,(H,16,21)(H,17,18)/t9-/m0/s1 |
| InChIKey | PBQYTVVQGQKPNN-VIFPVBQESA-N |
| XLogP | 0.81 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |