C18H14FN5O — CID 118262578
2-fluoro-4-[(8-methyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]benzonitrile (PubChem CID 118262578) has the molecular formula C18H14FN5O and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-fluoro-4-[(8-methyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]benzonitrile.
| Compound Name | 2-fluoro-4-[(8-methyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 118262578 |
| Molecular Formula | C18H14FN5O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-fluoro-4-[(8-methyl-3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]benzonitrile |
| SMILES | Cn1c2c(c3ccc(Nc4ccc(C#N)c(F)c4)nc31)C(=O)NCC2 |
| InChI | InChI=1S/C18H14FN5O/c1-24-14-6-7-21-18(25)16(14)12-4-5-15(23-17(12)24)22-11-3-2-10(9-20)13(19)8-11/h2-5,8H,6-7H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | BDNVBRPADLWWOG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |