C24H33N5 — CID 161225949
methane;9-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine (PubChem CID 161225949) has the molecular formula C24H33N5 and a molecular weight of 391.56 g/mol. Its IUPAC name is methane;9-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine.
| Compound Name | methane;9-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 161225949 |
| Molecular Formula | C24H33N5 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | methane;9-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
| SMILES | C.CN1CCN(c2ccc(Nc3ccc4c5c(n(C)c4n3)CCCC5)cc2)CC1 |
| InChI | InChI=1S/C23H29N5.CH4/c1-26-13-15-28(16-14-26)18-9-7-17(8-10-18)24-22-12-11-20-19-5-3-4-6-21(19)27(2)23(20)25-22;/h7-12H,3-6,13-16H2,1-2H3,(H,24,25);1H4 |
| InChIKey | UYCWPEBMHUWNER-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|