C23H28N4O2S — CID 58512442
5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine (PubChem CID 58512442) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine.
| Compound Name | 5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 58512442 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 5-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine |
| SMILES | CN1CCN(c2ccc(Nc3ccc4c(c3)c3c(n4C)CCS(=O)(=O)C3)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O2S/c1-25-10-12-27(13-11-25)19-6-3-17(4-7-19)24-18-5-8-22-20(15-18)21-16-30(28,29)14-9-23(21)26(22)2/h3-8,15,24H,9-14,16H2,1-2H3 |
| InChIKey | AHAXFVFFDOMSHN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|