C28H27N5O — CID 123811250
1-[(2-isocyanophenyl)methyl]-7-[4-(4-methylpiperazin-1-yl)anilino]quinolin-2-one (PubChem CID 123811250) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[(2-isocyanophenyl)methyl]-7-[4-(4-methylpiperazin-1-yl)anilino]quinolin-2-one.
| Compound Name | 1-[(2-isocyanophenyl)methyl]-7-[4-(4-methylpiperazin-1-yl)anilino]quinolin-2-one |
|---|---|
| PubChem CID | 123811250 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-[(2-isocyanophenyl)methyl]-7-[4-(4-methylpiperazin-1-yl)anilino]quinolin-2-one |
| SMILES | [C-]#[N+]c1ccccc1Cn1c(=O)ccc2ccc(Nc3ccc(N4CCN(C)CC4)cc3)cc21 |
| InChI | InChI=1S/C28H27N5O/c1-29-26-6-4-3-5-22(26)20-33-27-19-24(9-7-21(27)8-14-28(33)34)30-23-10-12-25(13-11-23)32-17-15-31(2)16-18-32/h3-14,19,30H,15-18,20H2,2H3 |
| InChIKey | MWNHUANXNFEBRM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|