C24H30N2O3S — CID 161226680
methane;5-methyl-8-[(4-morpholin-4-ylphenyl)methyl]-3,4-dihydro-1H-thiopyrano[4,3-b]indole 2,2-dioxide (PubChem CID 161226680) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is methane;5-methyl-8-[(4-morpholin-4-ylphenyl)methyl]-3,4-dihydro-1H-thiopyrano[4,3-b]indole 2,2-dioxide.
| Compound Name | methane;5-methyl-8-[(4-morpholin-4-ylphenyl)methyl]-3,4-dihydro-1H-thiopyrano[4,3-b]indole 2,2-dioxide |
|---|---|
| PubChem CID | 161226680 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | methane;5-methyl-8-[(4-morpholin-4-ylphenyl)methyl]-3,4-dihydro-1H-thiopyrano[4,3-b]indole 2,2-dioxide |
| SMILES | C.Cn1c2c(c3cc(Cc4ccc(N5CCOCC5)cc4)ccc31)CS(=O)(=O)CC2 |
| InChI | InChI=1S/C23H26N2O3S.CH4/c1-24-22-7-4-18(15-20(22)21-16-29(26,27)13-8-23(21)24)14-17-2-5-19(6-3-17)25-9-11-28-12-10-25;/h2-7,15H,8-14,16H2,1H3;1H4 |
| InChIKey | UYFIGDXQJKTLHH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|