C22H25N3O3S — CID 58512415
5-methyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine (PubChem CID 58512415) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 5-methyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine.
| Compound Name | 5-methyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 58512415 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 5-methyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxo-3,4-dihydro-1H-thiopyrano[4,3-b]indol-8-amine |
| SMILES | Cn1c2c(c3cc(Nc4ccc(N5CCOCC5)cc4)ccc31)CS(=O)(=O)CC2 |
| InChI | InChI=1S/C22H25N3O3S/c1-24-21-7-4-17(14-19(21)20-15-29(26,27)13-8-22(20)24)23-16-2-5-18(6-3-16)25-9-11-28-12-10-25/h2-7,14,23H,8-13,15H2,1H3 |
| InChIKey | ZHSKYGMFTAJALE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|