C21H30N2O6S — CID 11826277
ethyl 3,3-diethoxy-2-[[1-(4-methylphenyl)sulfonylpyrrol-2-yl]methylamino]propanoate (PubChem CID 11826277) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is ethyl 3,3-diethoxy-2-[[1-(4-methylphenyl)sulfonylpyrrol-2-yl]methylamino]propanoate.
| Compound Name | ethyl 3,3-diethoxy-2-[[1-(4-methylphenyl)sulfonylpyrrol-2-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 11826277 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | ethyl 3,3-diethoxy-2-[[1-(4-methylphenyl)sulfonylpyrrol-2-yl]methylamino]propanoate |
| SMILES | CCOC(=O)C(NCc1cccn1S(=O)(=O)c1ccc(C)cc1)C(OCC)OCC |
| InChI | InChI=1S/C21H30N2O6S/c1-5-27-20(24)19(21(28-6-2)29-7-3)22-15-17-9-8-14-23(17)30(25,26)18-12-10-16(4)11-13-18/h8-14,19,21-22H,5-7,15H2,1-4H3 |
| InChIKey | GVTJNKGRSYVGEI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|