C21H27ClN2O — CID 118263353
3-chloro-1-(3-methylbutyl)-4-(4-phenylpiperidin-1-yl)pyridin-2-one (PubChem CID 118263353) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 3-chloro-1-(3-methylbutyl)-4-(4-phenylpiperidin-1-yl)pyridin-2-one.
| Compound Name | 3-chloro-1-(3-methylbutyl)-4-(4-phenylpiperidin-1-yl)pyridin-2-one |
|---|---|
| PubChem CID | 118263353 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-chloro-1-(3-methylbutyl)-4-(4-phenylpiperidin-1-yl)pyridin-2-one |
| SMILES | CC(C)CCn1ccc(N2CCC(c3ccccc3)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C21H27ClN2O/c1-16(2)8-12-24-15-11-19(20(22)21(24)25)23-13-9-18(10-14-23)17-6-4-3-5-7-17/h3-7,11,15-16,18H,8-10,12-14H2,1-2H3 |
| InChIKey | TXYLBLGDEXWYSW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |