C19H29N3O3 — CID 118263628
methyl 2-[3-hydroxy-4-[(2-methylcyclohexyl)amino]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 118263628) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is methyl 2-[3-hydroxy-4-[(2-methylcyclohexyl)amino]piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[3-hydroxy-4-[(2-methylcyclohexyl)amino]piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118263628 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | methyl 2-[3-hydroxy-4-[(2-methylcyclohexyl)amino]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1CCC(NC2CCCCC2C)C(O)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-13-6-3-4-8-15(13)21-16-9-11-22(12-17(16)23)18-14(19(24)25-2)7-5-10-20-18/h5,7,10,13,15-17,21,23H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | UAHNCCDWUCERNS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |