C20H30N2O4 — CID 134413003
methyl 2-[3-hydroxy-4-[(2-methoxycyclohexyl)methyl]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 134413003) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 2-[3-hydroxy-4-[(2-methoxycyclohexyl)methyl]piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[3-hydroxy-4-[(2-methoxycyclohexyl)methyl]piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134413003 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl 2-[3-hydroxy-4-[(2-methoxycyclohexyl)methyl]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1CCC(CC2CCCCC2OC)C(O)C1 |
| InChI | InChI=1S/C20H30N2O4/c1-25-18-8-4-3-6-15(18)12-14-9-11-22(13-17(14)23)19-16(20(24)26-2)7-5-10-21-19/h5,7,10,14-15,17-18,23H,3-4,6,8-9,11-13H2,1-2H3 |
| InChIKey | JWMCUBLPARHJTP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |