C13H15BrF2N2O2 — CID 175582365
methyl 2-(5-bromo-4,4-difluoroazepan-1-yl)pyridine-3-carboxylate (PubChem CID 175582365) has the molecular formula C13H15BrF2N2O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is methyl 2-(5-bromo-4,4-difluoroazepan-1-yl)pyridine-3-carboxylate.
| Compound Name | methyl 2-(5-bromo-4,4-difluoroazepan-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175582365 |
| Molecular Formula | C13H15BrF2N2O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 2-(5-bromo-4,4-difluoroazepan-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1CCC(Br)C(F)(F)CC1 |
| InChI | InChI=1S/C13H15BrF2N2O2/c1-20-12(19)9-3-2-6-17-11(9)18-7-4-10(14)13(15,16)5-8-18/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | UFRFCPYCMFJCEF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|