C20H30N2O3 — CID 134413006
methyl 2-[4-(cycloheptylmethyl)-3-hydroxypiperidin-1-yl]pyridine-3-carboxylate (PubChem CID 134413006) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 2-[4-(cycloheptylmethyl)-3-hydroxypiperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[4-(cycloheptylmethyl)-3-hydroxypiperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134413006 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | methyl 2-[4-(cycloheptylmethyl)-3-hydroxypiperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1CCC(CC2CCCCCC2)C(O)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-25-20(24)17-9-6-11-21-19(17)22-12-10-16(18(23)14-22)13-15-7-4-2-3-5-8-15/h6,9,11,15-16,18,23H,2-5,7-8,10,12-14H2,1H3 |
| InChIKey | UCAWKKZKZSVWQJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |