C21H32BrN5O — CID 118263663
N-(1-amino-2-methylpropylidene)-5-bromo-2-[4-(cyclohexylamino)piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 118263663) has the molecular formula C21H32BrN5O and a molecular weight of 450.43 g/mol. Its IUPAC name is N-(1-amino-2-methylpropylidene)-5-bromo-2-[4-(cyclohexylamino)piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(1-amino-2-methylpropylidene)-5-bromo-2-[4-(cyclohexylamino)piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118263663 |
| Molecular Formula | C21H32BrN5O |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-(1-amino-2-methylpropylidene)-5-bromo-2-[4-(cyclohexylamino)piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CC(C)/C(N)=N\C(=O)c1cc(Br)cnc1N1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H32BrN5O/c1-14(2)19(23)26-21(28)18-12-15(22)13-24-20(18)27-10-8-17(9-11-27)25-16-6-4-3-5-7-16/h12-14,16-17,25H,3-11H2,1-2H3,(H2,23,26,28) |
| InChIKey | HASHLZRZZZPOLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|