C23H35N5O2 — CID 118263971
N-[amino(cyclopropyl)methylidene]-2-[(3S,4R)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide (PubChem CID 118263971) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[amino(cyclopropyl)methylidene]-2-[(3S,4R)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-[amino(cyclopropyl)methylidene]-2-[(3S,4R)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118263971 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-[amino(cyclopropyl)methylidene]-2-[(3S,4R)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
| SMILES | CO[C@H]1CN(c2ncc(C)cc2C(=O)/N=C(\N)C2CC2)CC[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C23H35N5O2/c1-15-12-18(23(29)27-21(24)16-8-9-16)22(25-13-15)28-11-10-19(20(14-28)30-2)26-17-6-4-3-5-7-17/h12-13,16-17,19-20,26H,3-11,14H2,1-2H3,(H2,24,27,29)/t19-,20+/m1/s1 |
| InChIKey | BFYPLYLMYYLFMN-UXHICEINSA-N |
| XLogP | 2.81 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|