C22H35N5O2 — CID 140681742
2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methyl-N-propanimidoylpyridine-3-carboxamide (PubChem CID 140681742) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methyl-N-propanimidoylpyridine-3-carboxamide.
| Compound Name | 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methyl-N-propanimidoylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140681742 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methyl-N-propanimidoylpyridine-3-carboxamide |
| SMILES | [H]/N=C(\CC)NC(=O)c1cc(C)cnc1N1CCC(NC2CCCCC2)C(OC)C1 |
| InChI | InChI=1S/C22H35N5O2/c1-4-20(23)26-22(28)17-12-15(2)13-24-21(17)27-11-10-18(19(14-27)29-3)25-16-8-6-5-7-9-16/h12-13,16,18-19,25H,4-11,14H2,1-3H3,(H2,23,26,28) |
| InChIKey | IVPVWJUGFQWPDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|