C25H35N5O2 — CID 140681712
2-[(3R,4R)-4-(cyclohexylamino)-3-hydroxypiperidin-1-yl]-6-methyl-N-propanimidoylquinoline-3-carboxamide (PubChem CID 140681712) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[(3R,4R)-4-(cyclohexylamino)-3-hydroxypiperidin-1-yl]-6-methyl-N-propanimidoylquinoline-3-carboxamide.
| Compound Name | 2-[(3R,4R)-4-(cyclohexylamino)-3-hydroxypiperidin-1-yl]-6-methyl-N-propanimidoylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 140681712 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-[(3R,4R)-4-(cyclohexylamino)-3-hydroxypiperidin-1-yl]-6-methyl-N-propanimidoylquinoline-3-carboxamide |
| SMILES | [H]/N=C(\CC)NC(=O)c1cc2cc(C)ccc2nc1N1CC[C@@H](NC2CCCCC2)[C@H](O)C1 |
| InChI | InChI=1S/C25H35N5O2/c1-3-23(26)29-25(32)19-14-17-13-16(2)9-10-20(17)28-24(19)30-12-11-21(22(31)15-30)27-18-7-5-4-6-8-18/h9-10,13-14,18,21-22,27,31H,3-8,11-12,15H2,1-2H3,(H2,26,29,32)/t21-,22-/m1/s1 |
| InChIKey | LSJBYQIZGINGDE-FGZHOGPDSA-N |
| XLogP | 3.52 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|