C25H33N5 — CID 118264014
N-cyclopentyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]-6-methylquinolin-2-yl]piperidin-4-amine (PubChem CID 118264014) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-cyclopentyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]-6-methylquinolin-2-yl]piperidin-4-amine.
| Compound Name | N-cyclopentyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]-6-methylquinolin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 118264014 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | N-cyclopentyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]-6-methylquinolin-2-yl]piperidin-4-amine |
| SMILES | [H]/N=C(C)\C=C/C(=N\[H])c1cc2cc(C)ccc2nc1N1CCC(NC2CCCC2)CC1 |
| InChI | InChI=1S/C25H33N5/c1-17-7-10-24-19(15-17)16-22(23(27)9-8-18(2)26)25(29-24)30-13-11-21(12-14-30)28-20-5-3-4-6-20/h7-10,15-16,20-21,26-28H,3-6,11-14H2,1-2H3/b9-8-,26-18-,27-23+ |
| InChIKey | JKEGWBWIWDMMRY-DPBZSTSPSA-N |
| XLogP | 5.01 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|