C23H31N5O — CID 118263989
N-[amino-[2-[4-(cyclopentylamino)piperidin-1-yl]-6-methylquinolin-3-yl]methylidene]acetamide (PubChem CID 118263989) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-[amino-[2-[4-(cyclopentylamino)piperidin-1-yl]-6-methylquinolin-3-yl]methylidene]acetamide.
| Compound Name | N-[amino-[2-[4-(cyclopentylamino)piperidin-1-yl]-6-methylquinolin-3-yl]methylidene]acetamide |
|---|---|
| PubChem CID | 118263989 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[amino-[2-[4-(cyclopentylamino)piperidin-1-yl]-6-methylquinolin-3-yl]methylidene]acetamide |
| SMILES | CC(=O)/N=C(\N)c1cc2cc(C)ccc2nc1N1CCC(NC2CCCC2)CC1 |
| InChI | InChI=1S/C23H31N5O/c1-15-7-8-21-17(13-15)14-20(22(24)25-16(2)29)23(27-21)28-11-9-19(10-12-28)26-18-5-3-4-6-18/h7-8,13-14,18-19,26H,3-6,9-12H2,1-2H3,(H2,24,25,29) |
| InChIKey | SYJNOPOKPQDMQZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|