C25H31N5 — CID 118264097
N-cyclohexyl-1-(6-methyl-3-pyrimidin-4-ylquinolin-2-yl)piperidin-4-amine (PubChem CID 118264097) has the molecular formula C25H31N5 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-cyclohexyl-1-(6-methyl-3-pyrimidin-4-ylquinolin-2-yl)piperidin-4-amine.
| Compound Name | N-cyclohexyl-1-(6-methyl-3-pyrimidin-4-ylquinolin-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 118264097 |
| Molecular Formula | C25H31N5 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | N-cyclohexyl-1-(6-methyl-3-pyrimidin-4-ylquinolin-2-yl)piperidin-4-amine |
| SMILES | Cc1ccc2nc(N3CCC(NC4CCCCC4)CC3)c(-c3ccncn3)cc2c1 |
| InChI | InChI=1S/C25H31N5/c1-18-7-8-23-19(15-18)16-22(24-9-12-26-17-27-24)25(29-23)30-13-10-21(11-14-30)28-20-5-3-2-4-6-20/h7-9,12,15-17,20-21,28H,2-6,10-11,13-14H2,1H3 |
| InChIKey | XCLKLLPHNKLKII-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |